C14H14F2N2OS — CID 15290000
3-[(2S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-4-(hydroxymethyl)-1H-imidazole-2-thione (PubChem CID 15290000) has the molecular formula C14H14F2N2OS and a molecular weight of 296.34 g/mol. Its IUPAC name is 3-[(2S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-4-(hydroxymethyl)-1H-imidazole-2-thione.
| Compound Name | 3-[(2S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-4-(hydroxymethyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 15290000 |
| Molecular Formula | C14H14F2N2OS |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-[(2S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-4-(hydroxymethyl)-1H-imidazole-2-thione |
| SMILES | OCc1c[nH]c(=S)n1[C@H]1CCc2c(F)cc(F)cc2C1 |
| InChI | InChI=1S/C14H14F2N2OS/c15-9-3-8-4-10(1-2-12(8)13(16)5-9)18-11(7-19)6-17-14(18)20/h3,5-6,10,19H,1-2,4,7H2,(H,17,20)/t10-/m0/s1 |
| InChIKey | PQYYOSUOSIACJE-JTQLQIEISA-N |
| XLogP | 3.05 |
| TPSA | 40.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|