C11H13NO3S — CID 152907275
ethyl 2-(2,3-dihydro-1,2-benzothiazol-5-yloxy)acetate (PubChem CID 152907275) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is ethyl 2-(2,3-dihydro-1,2-benzothiazol-5-yloxy)acetate.
| Compound Name | ethyl 2-(2,3-dihydro-1,2-benzothiazol-5-yloxy)acetate |
|---|---|
| PubChem CID | 152907275 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | ethyl 2-(2,3-dihydro-1,2-benzothiazol-5-yloxy)acetate |
| SMILES | CCOC(=O)COc1ccc2c(c1)CNS2 |
| InChI | InChI=1S/C11H13NO3S/c1-2-14-11(13)7-15-9-3-4-10-8(5-9)6-12-16-10/h3-5,12H,2,6-7H2,1H3 |
| InChIKey | UGMOJEQBXBIEEU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|