C11H12BrNOS — CID 15291657
2-bromo-1-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)ethanone (PubChem CID 15291657) has the molecular formula C11H12BrNOS and a molecular weight of 286.19 g/mol. Its IUPAC name is 2-bromo-1-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)ethanone.
| Compound Name | 2-bromo-1-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)ethanone |
|---|---|
| PubChem CID | 15291657 |
| Molecular Formula | C11H12BrNOS |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 2-bromo-1-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)ethanone |
| SMILES | O=C(CBr)N1CCSc2ccccc2C1 |
| InChI | InChI=1S/C11H12BrNOS/c12-7-11(14)13-5-6-15-10-4-2-1-3-9(10)8-13/h1-4H,5-8H2 |
| InChIKey | ZLTKNXJPRKGKEX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|