C15H14BrNO — CID 15292142
2-bromo-N-(2,3-dihydro-1H-phenalen-2-yl)acetamide (PubChem CID 15292142) has the molecular formula C15H14BrNO and a molecular weight of 304.19 g/mol. Its IUPAC name is 2-bromo-N-(2,3-dihydro-1H-phenalen-2-yl)acetamide.
| Compound Name | 2-bromo-N-(2,3-dihydro-1H-phenalen-2-yl)acetamide |
|---|---|
| PubChem CID | 15292142 |
| Molecular Formula | C15H14BrNO |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-bromo-N-(2,3-dihydro-1H-phenalen-2-yl)acetamide |
| SMILES | O=C(CBr)NC1Cc2cccc3cccc(c23)C1 |
| InChI | InChI=1S/C15H14BrNO/c16-9-14(18)17-13-7-11-5-1-3-10-4-2-6-12(8-13)15(10)11/h1-6,13H,7-9H2,(H,17,18) |
| InChIKey | DJEVXRVISVWTKJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|