About methyl 4-formylbenzoate
methyl 4-formylbenzoate (PubChem CID 15294) has the molecular formula C9H8O3
and a molecular weight of 164.16 g/mol. Its IUPAC name is methyl 4-formylbenzoate.
Molecular Properties
| Compound Name | methyl 4-formylbenzoate |
| PubChem CID | 15294 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | methyl 4-formylbenzoate |
| SMILES | COC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C9H8O3/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-6H,1H3 |
| InChIKey | FEIOASZZURHTHB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-formylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-formylbenzoate?
The IUPAC name of methyl 4-formylbenzoate (CID 15294) is methyl 4-formylbenzoate.
What is the SMILES notation for methyl 4-formylbenzoate?
The canonical SMILES for methyl 4-formylbenzoate is COC(=O)c1ccc(C=O)cc1.
What is the InChIKey of methyl 4-formylbenzoate?
The InChIKey is FEIOASZZURHTHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-6H,1H3.
What are the key properties of methyl 4-formylbenzoate?
methyl 4-formylbenzoate has a molecular weight of 164.16 g/mol, XLogP of 1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-formylbenzoate is sourced from PubChem (CID 15294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).