C11H5F4NOS — CID 152953075
1-[5-(2,3,5,6-tetrafluoro-4-pyridinyl)thiophen-2-yl]ethanone (PubChem CID 152953075) has the molecular formula C11H5F4NOS and a molecular weight of 275.23 g/mol. Its IUPAC name is 1-[5-(2,3,5,6-tetrafluoro-4-pyridinyl)thiophen-2-yl]ethanone.
| Compound Name | 1-[5-(2,3,5,6-tetrafluoro-4-pyridinyl)thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 152953075 |
| Molecular Formula | C11H5F4NOS |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 1-[5-(2,3,5,6-tetrafluoro-4-pyridinyl)thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1ccc(-c2c(F)c(F)nc(F)c2F)s1 |
| InChI | InChI=1S/C11H5F4NOS/c1-4(17)5-2-3-6(18-5)7-8(12)10(14)16-11(15)9(7)13/h2-3H,1H3 |
| InChIKey | UPBYJZXQEWSFCO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|