C27H31N3O2 — CID 15296377
4-[4-(2-methoxyphenyl)piperazin-1-yl]-2-phenyl-N,N-bis(prop-2-ynyl)butanamide (PubChem CID 15296377) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 4-[4-(2-methoxyphenyl)piperazin-1-yl]-2-phenyl-N,N-bis(prop-2-ynyl)butanamide.
| Compound Name | 4-[4-(2-methoxyphenyl)piperazin-1-yl]-2-phenyl-N,N-bis(prop-2-ynyl)butanamide |
|---|---|
| PubChem CID | 15296377 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 4-[4-(2-methoxyphenyl)piperazin-1-yl]-2-phenyl-N,N-bis(prop-2-ynyl)butanamide |
| SMILES | C#CCN(CC#C)C(=O)C(CCN1CCN(c2ccccc2OC)CC1)c1ccccc1 |
| InChI | InChI=1S/C27H31N3O2/c1-4-16-30(17-5-2)27(31)24(23-11-7-6-8-12-23)15-18-28-19-21-29(22-20-28)25-13-9-10-14-26(25)32-3/h1-2,6-14,24H,15-22H2,3H3 |
| InChIKey | NYKOHLSBYOFUKF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|