C28H40Cl2N2O2 — CID 22244113
1-cyclohexyl-4-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-phenylbutan-1-one;dihydrochloride (PubChem CID 22244113) has the molecular formula C28H40Cl2N2O2 and a molecular weight of 507.55 g/mol. Its IUPAC name is 1-cyclohexyl-4-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-phenylbutan-1-one;dihydrochloride.
| Compound Name | 1-cyclohexyl-4-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-phenylbutan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 22244113 |
| Molecular Formula | C28H40Cl2N2O2 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 1-cyclohexyl-4-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-phenylbutan-1-one;dihydrochloride |
| SMILES | CCOc1ccccc1N1CCN(CCC(C(=O)C2CCCCC2)c2ccccc2)CC1.Cl.Cl |
| InChI | InChI=1S/C28H38N2O2.2ClH/c1-2-32-27-16-10-9-15-26(27)30-21-19-29(20-22-30)18-17-25(23-11-5-3-6-12-23)28(31)24-13-7-4-8-14-24;;/h3,5-6,9-12,15-16,24-25H,2,4,7-8,13-14,17-22H2,1H3;2*1H |
| InChIKey | DMKZVODCSZJILN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |