C22H29N5O3 — CID 164929662
1-[6-[4-(2-ethoxyphenyl)piperazin-1-yl]pyrimidin-4-yl]piperidine-4-carboxylic acid (PubChem CID 164929662) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-[6-[4-(2-ethoxyphenyl)piperazin-1-yl]pyrimidin-4-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-[4-(2-ethoxyphenyl)piperazin-1-yl]pyrimidin-4-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 164929662 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 1-[6-[4-(2-ethoxyphenyl)piperazin-1-yl]pyrimidin-4-yl]piperidine-4-carboxylic acid |
| SMILES | CCOc1ccccc1N1CCN(c2cc(N3CCC(C(=O)O)CC3)ncn2)CC1 |
| InChI | InChI=1S/C22H29N5O3/c1-2-30-19-6-4-3-5-18(19)25-11-13-27(14-12-25)21-15-20(23-16-24-21)26-9-7-17(8-10-26)22(28)29/h3-6,15-17H,2,7-14H2,1H3,(H,28,29) |
| InChIKey | ZDNYWDQDWCTRDE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |