C16H25NO4S — CID 15296673
2-benzyl-3-[2-(diethylamino)ethylsulfonyl]propanoic acid (PubChem CID 15296673) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-benzyl-3-[2-(diethylamino)ethylsulfonyl]propanoic acid.
| Compound Name | 2-benzyl-3-[2-(diethylamino)ethylsulfonyl]propanoic acid |
|---|---|
| PubChem CID | 15296673 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-benzyl-3-[2-(diethylamino)ethylsulfonyl]propanoic acid |
| SMILES | CCN(CC)CCS(=O)(=O)CC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H25NO4S/c1-3-17(4-2)10-11-22(20,21)13-15(16(18)19)12-14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3,(H,18,19) |
| InChIKey | NISACDTZEZGVNM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |