C20H20N6O2 — CID 152996015
cis-(1R,2S)-N-[8-amino-6-(3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazin-8-yl)-2,7-naphthyridin-3-yl]-2-methylcyclopropane-1-carboxamide (PubChem CID 152996015) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is cis-(1R,2S)-N-[8-amino-6-(3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazin-8-yl)-2,7-naphthyridin-3-yl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[8-amino-6-(3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazin-8-yl)-2,7-naphthyridin-3-yl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 152996015 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | cis-(1R,2S)-N-[8-amino-6-(3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazin-8-yl)-2,7-naphthyridin-3-yl]-2-methylcyclopropane-1-carboxamide |
| SMILES | C[C@H]1C[C@H]1C(=O)Nc1cc2cc(-c3cncc4c3OCCN4)nc(N)c2cn1 |
| InChI | InChI=1S/C20H20N6O2/c1-10-4-12(10)20(27)26-17-6-11-5-15(25-19(21)13(11)8-24-17)14-7-22-9-16-18(14)28-3-2-23-16/h5-10,12,23H,2-4H2,1H3,(H2,21,25)(H,24,26,27)/t10-,12+/m0/s1 |
| InChIKey | UXFHWBAJSHERCF-CMPLNLGQSA-N |
| XLogP | 2.67 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |