C11H20N2 — CID 153015445
5-ethyl-N,N,1,3-tetramethyl-2H-pyridin-2-amine (PubChem CID 153015445) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 5-ethyl-N,N,1,3-tetramethyl-2H-pyridin-2-amine.
| Compound Name | 5-ethyl-N,N,1,3-tetramethyl-2H-pyridin-2-amine |
|---|---|
| PubChem CID | 153015445 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 5-ethyl-N,N,1,3-tetramethyl-2H-pyridin-2-amine |
| SMILES | CCC1=CN(C)C(N(C)C)C(C)=C1 |
| InChI | InChI=1S/C11H20N2/c1-6-10-7-9(2)11(12(3)4)13(5)8-10/h7-8,11H,6H2,1-5H3 |
| InChIKey | VAWQYCLMAGSYMO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |