C18H28N4OS — CID 153036522
(4aR,8aR)-7-(5-cyclohexyl-1,3-thiazolidin-2-yl)-8-oxo-3,4,4a,5,6,8a-hexahydro-1H-2,7-naphthyridine-2-carbonitrile (PubChem CID 153036522) has the molecular formula C18H28N4OS and a molecular weight of 348.52 g/mol. Its IUPAC name is (4aR,8aR)-7-(5-cyclohexyl-1,3-thiazolidin-2-yl)-8-oxo-3,4,4a,5,6,8a-hexahydro-1H-2,7-naphthyridine-2-carbonitrile.
| Compound Name | (4aR,8aR)-7-(5-cyclohexyl-1,3-thiazolidin-2-yl)-8-oxo-3,4,4a,5,6,8a-hexahydro-1H-2,7-naphthyridine-2-carbonitrile |
|---|---|
| PubChem CID | 153036522 |
| Molecular Formula | C18H28N4OS |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (4aR,8aR)-7-(5-cyclohexyl-1,3-thiazolidin-2-yl)-8-oxo-3,4,4a,5,6,8a-hexahydro-1H-2,7-naphthyridine-2-carbonitrile |
| SMILES | N#CN1CC[C@@H]2CCN(C3NCC(C4CCCCC4)S3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C18H28N4OS/c19-12-21-8-6-13-7-9-22(17(23)15(13)11-21)18-20-10-16(24-18)14-4-2-1-3-5-14/h13-16,18,20H,1-11H2/t13-,15+,16?,18?/m1/s1 |
| InChIKey | SYWOZQHAYGIYLF-SPCOIHFJSA-N |
| XLogP | 2.21 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|