C15H19N3O2S — CID 158609263
(3R)-3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonylmethyl)pyrrolidine-1-carbonitrile (PubChem CID 158609263) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is (3R)-3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonylmethyl)pyrrolidine-1-carbonitrile.
| Compound Name | (3R)-3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonylmethyl)pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 158609263 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (3R)-3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonylmethyl)pyrrolidine-1-carbonitrile |
| SMILES | N#CN1CC[C@@H](CS(=O)(=O)N2CCc3ccccc3C2)C1 |
| InChI | InChI=1S/C15H19N3O2S/c16-12-17-7-5-13(9-17)11-21(19,20)18-8-6-14-3-1-2-4-15(14)10-18/h1-4,13H,5-11H2/t13-/m1/s1 |
| InChIKey | HWPXBKHADFKKFF-CYBMUJFWSA-N |
| XLogP | 1.18 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|