C29H31N3O4 — CID 153039408
N-(1-hydroxy-2,4-dioxohexan-3-yl)-N-methyl-4-[2-[4-[3-(1-methylimidazol-2-yl)propyl]phenyl]ethynyl]benzamide (PubChem CID 153039408) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is N-(1-hydroxy-2,4-dioxohexan-3-yl)-N-methyl-4-[2-[4-[3-(1-methylimidazol-2-yl)propyl]phenyl]ethynyl]benzamide.
| Compound Name | N-(1-hydroxy-2,4-dioxohexan-3-yl)-N-methyl-4-[2-[4-[3-(1-methylimidazol-2-yl)propyl]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 153039408 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-(1-hydroxy-2,4-dioxohexan-3-yl)-N-methyl-4-[2-[4-[3-(1-methylimidazol-2-yl)propyl]phenyl]ethynyl]benzamide |
| SMILES | CCC(=O)C(C(=O)CO)N(C)C(=O)c1ccc(C#Cc2ccc(CCCc3nccn3C)cc2)cc1 |
| InChI | InChI=1S/C29H31N3O4/c1-4-25(34)28(26(35)20-33)32(3)29(36)24-16-14-23(15-17-24)13-12-22-10-8-21(9-11-22)6-5-7-27-30-18-19-31(27)2/h8-11,14-19,28,33H,4-7,20H2,1-3H3 |
| InChIKey | VFJOJEPKPMSOET-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|