C15H23NO — CID 15304084
5,5,6,6,10,10-hexamethyl-2-oxa-3-azatricyclo[5.3.1.04,11]undeca-1(11),3-diene (PubChem CID 15304084) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 5,5,6,6,10,10-hexamethyl-2-oxa-3-azatricyclo[5.3.1.04,11]undeca-1(11),3-diene.
| Compound Name | 5,5,6,6,10,10-hexamethyl-2-oxa-3-azatricyclo[5.3.1.04,11]undeca-1(11),3-diene |
|---|---|
| PubChem CID | 15304084 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 5,5,6,6,10,10-hexamethyl-2-oxa-3-azatricyclo[5.3.1.04,11]undeca-1(11),3-diene |
| SMILES | CC1(C)CCC2c3c(noc31)C(C)(C)C2(C)C |
| InChI | InChI=1S/C15H23NO/c1-13(2)8-7-9-10-11(16-17-12(10)13)15(5,6)14(9,3)4/h9H,7-8H2,1-6H3 |
| InChIKey | LSVXQMKCEFFFJF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |