C12H18N2O2 — CID 5407245
(NZ)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-ylidene)hydroxylamine (PubChem CID 5407245) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (NZ)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 5407245 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (NZ)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-ylidene)hydroxylamine |
| SMILES | CCCc1noc2c1/C(=N\O)CC(C)(C)C2 |
| InChI | InChI=1S/C12H18N2O2/c1-4-5-8-11-9(13-15)6-12(2,3)7-10(11)16-14-8/h15H,4-7H2,1-3H3/b13-9- |
| InChIKey | VRKGNIMYDDHFFF-LCYFTJDESA-N |
| XLogP | 2.78 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|