C15H23NO — CID 164668154
3,4,4,7-tetramethyl-5,6,7,8,8a,9-hexahydro-4aH-benzo[f][1,2]benzoxazole (PubChem CID 164668154) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 3,4,4,7-tetramethyl-5,6,7,8,8a,9-hexahydro-4aH-benzo[f][1,2]benzoxazole.
| Compound Name | 3,4,4,7-tetramethyl-5,6,7,8,8a,9-hexahydro-4aH-benzo[f][1,2]benzoxazole |
|---|---|
| PubChem CID | 164668154 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 3,4,4,7-tetramethyl-5,6,7,8,8a,9-hexahydro-4aH-benzo[f][1,2]benzoxazole |
| SMILES | Cc1noc2c1C(C)(C)C1CCC(C)CC1C2 |
| InChI | InChI=1S/C15H23NO/c1-9-5-6-12-11(7-9)8-13-14(15(12,3)4)10(2)16-17-13/h9,11-12H,5-8H2,1-4H3 |
| InChIKey | OCPMZJHBWVNQCW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |