C17H24O4 — CID 15304837
(3aS,4S,8aR)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4,5,8,8a-tetrahydro-3aH-cyclopenta[f][1,3]benzodioxole (PubChem CID 15304837) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3aS,4S,8aR)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4,5,8,8a-tetrahydro-3aH-cyclopenta[f][1,3]benzodioxole.
| Compound Name | (3aS,4S,8aR)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4,5,8,8a-tetrahydro-3aH-cyclopenta[f][1,3]benzodioxole |
|---|---|
| PubChem CID | 15304837 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (3aS,4S,8aR)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4,5,8,8a-tetrahydro-3aH-cyclopenta[f][1,3]benzodioxole |
| SMILES | CC1(C)O[C@H]2[C@H]([C@H]3COC(C)(C)O3)C3=C(C=CC3)C[C@H]2O1 |
| InChI | InChI=1S/C17H24O4/c1-16(2)18-9-13(20-16)14-11-7-5-6-10(11)8-12-15(14)21-17(3,4)19-12/h5-6,12-15H,7-9H2,1-4H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | MLYKIASGBJEVAM-APIJFGDWSA-N |
| XLogP | 2.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |