C18H25NO5 — CID 135019547
(1R,2R,6S,7S,14R)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-4,4-dimethyl-3,5-dioxa-8-azatetracyclo[6.6.0.02,6.010,14]tetradec-10-en-12-one (PubChem CID 135019547) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is (1R,2R,6S,7S,14R)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-4,4-dimethyl-3,5-dioxa-8-azatetracyclo[6.6.0.02,6.010,14]tetradec-10-en-12-one.
| Compound Name | (1R,2R,6S,7S,14R)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-4,4-dimethyl-3,5-dioxa-8-azatetracyclo[6.6.0.02,6.010,14]tetradec-10-en-12-one |
|---|---|
| PubChem CID | 135019547 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (1R,2R,6S,7S,14R)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-4,4-dimethyl-3,5-dioxa-8-azatetracyclo[6.6.0.02,6.010,14]tetradec-10-en-12-one |
| SMILES | CC1(C)OCC([C@H]2[C@@H]3OC(C)(C)O[C@@H]3[C@H]3[C@@H]4CC(=O)C=C4CN32)O1 |
| InChI | InChI=1S/C18H25NO5/c1-17(2)21-8-12(22-17)14-16-15(23-18(3,4)24-16)13-11-6-10(20)5-9(11)7-19(13)14/h5,11-16H,6-8H2,1-4H3/t11-,12?,13-,14+,15-,16+/m1/s1 |
| InChIKey | TXQBSFHTVAXXSR-SQABHXLBSA-N |
| XLogP | 1.24 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |