C13H21Cl2NO5 — CID 72736054
(3aR,4S,6S,6aS)-4-(dichloromethyl)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 72736054) has the molecular formula C13H21Cl2NO5 and a molecular weight of 342.22 g/mol. Its IUPAC name is (3aR,4S,6S,6aS)-4-(dichloromethyl)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole.
| Compound Name | (3aR,4S,6S,6aS)-4-(dichloromethyl)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 72736054 |
| Molecular Formula | C13H21Cl2NO5 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (3aR,4S,6S,6aS)-4-(dichloromethyl)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C(Cl)Cl)N(O)[C@H]2[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C13H21Cl2NO5/c1-12(2)18-5-6(19-12)7-9-10(21-13(3,4)20-9)8(11(14)15)16(7)17/h6-11,17H,5H2,1-4H3/t6-,7-,8-,9-,10+/m0/s1 |
| InChIKey | IKHSHSRYRARHIW-BQHMLIOBSA-N |
| XLogP | 1.90 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|