C16H25NO7 — CID 135028280
[(1R,2R,6S,7S,10R)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl] acetate (PubChem CID 135028280) has the molecular formula C16H25NO7 and a molecular weight of 343.38 g/mol. Its IUPAC name is [(1R,2R,6S,7S,10R)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl] acetate.
| Compound Name | [(1R,2R,6S,7S,10R)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl] acetate |
|---|---|
| PubChem CID | 135028280 |
| Molecular Formula | C16H25NO7 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | [(1R,2R,6S,7S,10R)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethyl-3,5,9-trioxa-8-azatricyclo[6.3.0.02,6]undecan-10-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H]2[C@H]3OC(C)(C)O[C@H]3[C@H]([C@H]3COC(C)(C)O3)N2O1 |
| InChI | InChI=1S/C16H25NO7/c1-8(18)20-11-6-9-13-14(23-16(4,5)22-13)12(17(9)24-11)10-7-19-15(2,3)21-10/h9-14H,6-7H2,1-5H3/t9-,10-,11-,12+,13-,14+/m1/s1 |
| InChIKey | LMKBKGHRTQNPEK-HUXGKSLCSA-N |
| XLogP | 0.94 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |