C19H17N5O2S — CID 15304868
4-[(3E)-1,1-dicyano-3-(phenylhydrazinylidene)prop-1-en-2-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 15304868) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is 4-[(3E)-1,1-dicyano-3-(phenylhydrazinylidene)prop-1-en-2-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[(3E)-1,1-dicyano-3-(phenylhydrazinylidene)prop-1-en-2-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 15304868 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 4-[(3E)-1,1-dicyano-3-(phenylhydrazinylidene)prop-1-en-2-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(/C=N/Nc2ccccc2)=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C19H17N5O2S/c1-24(2)27(25,26)18-10-8-15(9-11-18)19(16(12-20)13-21)14-22-23-17-6-4-3-5-7-17/h3-11,14,23H,1-2H3/b22-14+ |
| InChIKey | BKZBTRQXVXYNKW-HYARGMPZSA-N |
| XLogP | 2.84 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|