C16H21F2O6PS — CID 15304877
(1S,2R,3S,5R)-3-(benzenesulfonyl)-2-[diethoxyphosphoryl(difluoro)methyl]-6-oxabicyclo[3.1.0]hexane (PubChem CID 15304877) has the molecular formula C16H21F2O6PS and a molecular weight of 410.38 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-(benzenesulfonyl)-2-[diethoxyphosphoryl(difluoro)methyl]-6-oxabicyclo[3.1.0]hexane.
| Compound Name | (1S,2R,3S,5R)-3-(benzenesulfonyl)-2-[diethoxyphosphoryl(difluoro)methyl]-6-oxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 15304877 |
| Molecular Formula | C16H21F2O6PS |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (1S,2R,3S,5R)-3-(benzenesulfonyl)-2-[diethoxyphosphoryl(difluoro)methyl]-6-oxabicyclo[3.1.0]hexane |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@H]1[C@@H]2O[C@@H]2C[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H21F2O6PS/c1-3-22-25(19,23-4-2)16(17,18)14-13(10-12-15(14)24-12)26(20,21)11-8-6-5-7-9-11/h5-9,12-15H,3-4,10H2,1-2H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | IBTLPCXRUAXZHK-LXTVHRRPSA-N |
| XLogP | 3.48 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|