C19H27F2O7PS — CID 15304878
(3aS,4R,5S,6aR)-5-(benzenesulfonyl)-4-[diethoxyphosphoryl(difluoro)methyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole (PubChem CID 15304878) has the molecular formula C19H27F2O7PS and a molecular weight of 468.46 g/mol. Its IUPAC name is (3aS,4R,5S,6aR)-5-(benzenesulfonyl)-4-[diethoxyphosphoryl(difluoro)methyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole.
| Compound Name | (3aS,4R,5S,6aR)-5-(benzenesulfonyl)-4-[diethoxyphosphoryl(difluoro)methyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole |
|---|---|
| PubChem CID | 15304878 |
| Molecular Formula | C19H27F2O7PS |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | (3aS,4R,5S,6aR)-5-(benzenesulfonyl)-4-[diethoxyphosphoryl(difluoro)methyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@H]1[C@@H]2OC(C)(C)O[C@@H]2C[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H27F2O7PS/c1-5-25-29(22,26-6-2)19(20,21)16-15(12-14-17(16)28-18(3,4)27-14)30(23,24)13-10-8-7-9-11-13/h7-11,14-17H,5-6,12H2,1-4H3/t14-,15+,16-,17-/m1/s1 |
| InChIKey | KRZKTKOLMRMCAF-YYIAUSFCSA-N |
| XLogP | 4.23 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|