C21H31F2O6PS — CID 11049115
(3S)-3-[3-(benzenesulfinyl)-1-diethoxyphosphoryl-1,1-difluoropropan-2-yl]-1,4-dioxaspiro[4.5]decane (PubChem CID 11049115) has the molecular formula C21H31F2O6PS and a molecular weight of 480.51 g/mol. Its IUPAC name is (3S)-3-[3-(benzenesulfinyl)-1-diethoxyphosphoryl-1,1-difluoropropan-2-yl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | (3S)-3-[3-(benzenesulfinyl)-1-diethoxyphosphoryl-1,1-difluoropropan-2-yl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 11049115 |
| Molecular Formula | C21H31F2O6PS |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | (3S)-3-[3-(benzenesulfinyl)-1-diethoxyphosphoryl-1,1-difluoropropan-2-yl]-1,4-dioxaspiro[4.5]decane |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(CS(=O)c1ccccc1)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C21H31F2O6PS/c1-3-27-30(24,28-4-2)21(22,23)18(16-31(25)17-11-7-5-8-12-17)19-15-26-20(29-19)13-9-6-10-14-20/h5,7-8,11-12,18-19H,3-4,6,9-10,13-16H2,1-2H3/t18?,19-,31?/m1/s1 |
| InChIKey | HHSQUONANSDCIW-JQMUZSHQSA-N |
| XLogP | 5.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|