C17H26FO7PS — CID 101149173
4-[2-(benzenesulfonyl)-2-diethoxyphosphoryl-2-fluoroethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 101149173) has the molecular formula C17H26FO7PS and a molecular weight of 424.43 g/mol. Its IUPAC name is 4-[2-(benzenesulfonyl)-2-diethoxyphosphoryl-2-fluoroethyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[2-(benzenesulfonyl)-2-diethoxyphosphoryl-2-fluoroethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 101149173 |
| Molecular Formula | C17H26FO7PS |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 4-[2-(benzenesulfonyl)-2-diethoxyphosphoryl-2-fluoroethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCOP(=O)(OCC)C(F)(CC1COC(C)(C)O1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H26FO7PS/c1-5-23-26(19,24-6-2)17(18,12-14-13-22-16(3,4)25-14)27(20,21)15-10-8-7-9-11-15/h7-11,14H,5-6,12-13H2,1-4H3 |
| InChIKey | UCYFLRARRDYWDH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|