C16H22O4S — CID 11324357
2-[(E)-5-(benzenesulfonyl)-4-methylpent-3-enyl]-2-methyl-1,3-dioxolane (PubChem CID 11324357) has the molecular formula C16H22O4S and a molecular weight of 310.41 g/mol. Its IUPAC name is 2-[(E)-5-(benzenesulfonyl)-4-methylpent-3-enyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[(E)-5-(benzenesulfonyl)-4-methylpent-3-enyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11324357 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-[(E)-5-(benzenesulfonyl)-4-methylpent-3-enyl]-2-methyl-1,3-dioxolane |
| SMILES | C/C(=C\CCC1(C)OCCO1)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O4S/c1-14(7-6-10-16(2)19-11-12-20-16)13-21(17,18)15-8-4-3-5-9-15/h3-5,7-9H,6,10-13H2,1-2H3/b14-7+ |
| InChIKey | XOFSXGYTAVMARR-VGOFMYFVSA-N |
| XLogP | 2.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|