C15H18O4S — CID 10902484
8-(benzenesulfonyl)-1,4-dioxaspiro[4.6]undec-8-ene (PubChem CID 10902484) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-1,4-dioxaspiro[4.6]undec-8-ene.
| Compound Name | 8-(benzenesulfonyl)-1,4-dioxaspiro[4.6]undec-8-ene |
|---|---|
| PubChem CID | 10902484 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 8-(benzenesulfonyl)-1,4-dioxaspiro[4.6]undec-8-ene |
| SMILES | O=S(=O)(C1=CCCC2(CC1)OCCO2)c1ccccc1 |
| InChI | InChI=1S/C15H18O4S/c16-20(17,13-5-2-1-3-6-13)14-7-4-9-15(10-8-14)18-11-12-19-15/h1-3,5-7H,4,8-12H2 |
| InChIKey | LCVXZTHBKPAGLG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |