C13H18O4S — CID 166441229
4-[2-(benzenesulfonyl)ethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 166441229) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-[2-(benzenesulfonyl)ethyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[2-(benzenesulfonyl)ethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 166441229 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-[2-(benzenesulfonyl)ethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(CCS(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C13H18O4S/c1-13(2)16-10-11(17-13)8-9-18(14,15)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3 |
| InChIKey | HGFAWPLERLORHT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |