C15H19FO3S — CID 101245566
(3S)-3-[(S)-benzenesulfinyl(fluoro)methyl]-1,4-dioxaspiro[4.5]decane (PubChem CID 101245566) has the molecular formula C15H19FO3S and a molecular weight of 298.38 g/mol. Its IUPAC name is (3S)-3-[(S)-benzenesulfinyl(fluoro)methyl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | (3S)-3-[(S)-benzenesulfinyl(fluoro)methyl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 101245566 |
| Molecular Formula | C15H19FO3S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (3S)-3-[(S)-benzenesulfinyl(fluoro)methyl]-1,4-dioxaspiro[4.5]decane |
| SMILES | O=S(c1ccccc1)[C@H](F)[C@@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C15H19FO3S/c16-14(20(17)12-7-3-1-4-8-12)13-11-18-15(19-13)9-5-2-6-10-15/h1,3-4,7-8,13-14H,2,5-6,9-11H2/t13-,14-,20?/m0/s1 |
| InChIKey | CBYDXNPEEMIWDB-JWDIZXQDSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |