C35H48N4O2 — CID 15305114
tert-butyl 3,12-bis[(3-methylphenyl)methyl]-3,7,12,18-tetrazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7-carboxylate (PubChem CID 15305114) has the molecular formula C35H48N4O2 and a molecular weight of 556.80 g/mol. Its IUPAC name is tert-butyl 3,12-bis[(3-methylphenyl)methyl]-3,7,12,18-tetrazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7-carboxylate.
| Compound Name | tert-butyl 3,12-bis[(3-methylphenyl)methyl]-3,7,12,18-tetrazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7-carboxylate |
|---|---|
| PubChem CID | 15305114 |
| Molecular Formula | C35H48N4O2 |
| Molecular Weight | 556.80 g/mol |
| Exact Mass | 556.38 |
| IUPAC Name | tert-butyl 3,12-bis[(3-methylphenyl)methyl]-3,7,12,18-tetrazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7-carboxylate |
| SMILES | Cc1cccc(CN2CCCCN(C(=O)OC(C)(C)C)CCCN(Cc3cccc(C)c3)Cc3cccc(n3)C2)c1 |
| InChI | InChI=1S/C35H48N4O2/c1-28-12-8-14-30(22-28)24-37-18-6-7-20-39(34(40)41-35(3,4)5)21-11-19-38(25-31-15-9-13-29(2)23-31)27-33-17-10-16-32(26-37)36-33/h8-10,12-17,22-23H,6-7,11,18-21,24-27H2,1-5H3 |
| InChIKey | VXUGZOPHVPJKDD-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.80 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |