C24H27NO4 — CID 15306564
(1Z)-1-ethylidene-9,10-dimethoxy-4-(4-methoxyphenyl)-4,6,7,11b-tetrahydro-3H-benzo[a]quinolizin-2-one (PubChem CID 15306564) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is (1Z)-1-ethylidene-9,10-dimethoxy-4-(4-methoxyphenyl)-4,6,7,11b-tetrahydro-3H-benzo[a]quinolizin-2-one.
| Compound Name | (1Z)-1-ethylidene-9,10-dimethoxy-4-(4-methoxyphenyl)-4,6,7,11b-tetrahydro-3H-benzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 15306564 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (1Z)-1-ethylidene-9,10-dimethoxy-4-(4-methoxyphenyl)-4,6,7,11b-tetrahydro-3H-benzo[a]quinolizin-2-one |
| SMILES | C/C=C1\C(=O)CC(c2ccc(OC)cc2)N2CCc3cc(OC)c(OC)cc3C12 |
| InChI | InChI=1S/C24H27NO4/c1-5-18-21(26)14-20(15-6-8-17(27-2)9-7-15)25-11-10-16-12-22(28-3)23(29-4)13-19(16)24(18)25/h5-9,12-13,20,24H,10-11,14H2,1-4H3/b18-5+ |
| InChIKey | MLVQQINHRFKIQG-BLLMUTORSA-N |
| XLogP | 4.27 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|