C16H14N2O3S — CID 15306585
4-(4-methylanilino)quinoline-3-sulfonic acid (PubChem CID 15306585) has the molecular formula C16H14N2O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is 4-(4-methylanilino)quinoline-3-sulfonic acid.
| Compound Name | 4-(4-methylanilino)quinoline-3-sulfonic acid |
|---|---|
| PubChem CID | 15306585 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 4-(4-methylanilino)quinoline-3-sulfonic acid |
| SMILES | Cc1ccc(Nc2c(S(=O)(=O)O)cnc3ccccc23)cc1 |
| InChI | InChI=1S/C16H14N2O3S/c1-11-6-8-12(9-7-11)18-16-13-4-2-3-5-14(13)17-10-15(16)22(19,20)21/h2-10H,1H3,(H,17,18)(H,19,20,21) |
| InChIKey | XWNTZVWKCJKLFQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|