C14H12F2N2O3S — CID 153066549
N-(2,4-difluoro-3-methylphenyl)-3-sulfamoylbenzamide (PubChem CID 153066549) has the molecular formula C14H12F2N2O3S and a molecular weight of 326.32 g/mol. Its IUPAC name is N-(2,4-difluoro-3-methylphenyl)-3-sulfamoylbenzamide.
| Compound Name | N-(2,4-difluoro-3-methylphenyl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 153066549 |
| Molecular Formula | C14H12F2N2O3S |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | N-(2,4-difluoro-3-methylphenyl)-3-sulfamoylbenzamide |
| SMILES | Cc1c(F)ccc(NC(=O)c2cccc(S(N)(=O)=O)c2)c1F |
| InChI | InChI=1S/C14H12F2N2O3S/c1-8-11(15)5-6-12(13(8)16)18-14(19)9-3-2-4-10(7-9)22(17,20)21/h2-7H,1H3,(H,18,19)(H2,17,20,21) |
| InChIKey | VKMOXAIJZZNGLG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |