C24H23Cl2FN6O4 — CID 153069167
4-[2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-5-methoxy-2-oxo-1-pyridinyl]propanoylamino]-2-fluorobenzamide (PubChem CID 153069167) has the molecular formula C24H23Cl2FN6O4 and a molecular weight of 549.39 g/mol. Its IUPAC name is 4-[2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-5-methoxy-2-oxo-1-pyridinyl]propanoylamino]-2-fluorobenzamide.
| Compound Name | 4-[2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-5-methoxy-2-oxo-1-pyridinyl]propanoylamino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 153069167 |
| Molecular Formula | C24H23Cl2FN6O4 |
| Molecular Weight | 549.39 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 4-[2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-5-methoxy-2-oxo-1-pyridinyl]propanoylamino]-2-fluorobenzamide |
| SMILES | COc1cn(C(C)C(=O)Nc2ccc(C(N)=O)c(F)c2)c(=O)cc1-c1cc(Cl)ccc1N(N)/C=C(\N)Cl |
| InChI | InChI=1S/C24H23Cl2FN6O4/c1-12(24(36)31-14-4-5-15(23(29)35)18(27)8-14)32-10-20(37-2)17(9-22(32)34)16-7-13(25)3-6-19(16)33(30)11-21(26)28/h3-12H,28,30H2,1-2H3,(H2,29,35)(H,31,36)/b21-11- |
| InChIKey | VKZLZAFFYGDJAA-NHDPSOOVSA-N |
| XLogP | 3.29 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|