C29H31Cl2N7O3 — CID 155468295
2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-5-methoxy-2-oxo-1-pyridinyl]-N-[2-(cyclopropylmethyl)indazol-5-yl]butanamide (PubChem CID 155468295) has the molecular formula C29H31Cl2N7O3 and a molecular weight of 596.52 g/mol. Its IUPAC name is 2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-5-methoxy-2-oxo-1-pyridinyl]-N-[2-(cyclopropylmethyl)indazol-5-yl]butanamide.
| Compound Name | 2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-5-methoxy-2-oxo-1-pyridinyl]-N-[2-(cyclopropylmethyl)indazol-5-yl]butanamide |
|---|---|
| PubChem CID | 155468295 |
| Molecular Formula | C29H31Cl2N7O3 |
| Molecular Weight | 596.52 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | 2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-5-methoxy-2-oxo-1-pyridinyl]-N-[2-(cyclopropylmethyl)indazol-5-yl]butanamide |
| SMILES | CCC(C(=O)Nc1ccc2nn(CC3CC3)cc2c1)n1cc(OC)c(-c2cc(Cl)ccc2N(N)/C=C(\N)Cl)cc1=O |
| InChI | InChI=1S/C29H31Cl2N7O3/c1-3-24(29(40)34-20-7-8-23-18(10-20)14-36(35-23)13-17-4-5-17)37-15-26(41-2)22(12-28(37)39)21-11-19(30)6-9-25(21)38(33)16-27(31)32/h6-12,14-17,24H,3-5,13,32-33H2,1-2H3,(H,34,40)/b27-16- |
| InChIKey | QZYNOKBSIJUTBV-YUMHPJSZSA-N |
| XLogP | 5.20 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|