C31H30Cl2N6O4 — CID 139515094
ethyl 2-[4-[[2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-phenylpropanoyl]amino]phenyl]acetate (PubChem CID 139515094) has the molecular formula C31H30Cl2N6O4 and a molecular weight of 621.52 g/mol. Its IUPAC name is ethyl 2-[4-[[2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-phenylpropanoyl]amino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-phenylpropanoyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 139515094 |
| Molecular Formula | C31H30Cl2N6O4 |
| Molecular Weight | 621.52 g/mol |
| Exact Mass | 620.17 |
| IUPAC Name | ethyl 2-[4-[[2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-phenylpropanoyl]amino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NC(=O)C(Cc2ccccc2)n2cnc(-c3cc(Cl)ccc3N(N)/C=C(\N)Cl)cc2=O)cc1 |
| InChI | InChI=1S/C31H30Cl2N6O4/c1-2-43-30(41)15-21-8-11-23(12-9-21)37-31(42)27(14-20-6-4-3-5-7-20)38-19-36-25(17-29(38)40)24-16-22(32)10-13-26(24)39(35)18-28(33)34/h3-13,16-19,27H,2,14-15,34-35H2,1H3,(H,37,42)/b28-18- |
| InChIKey | CCOCTJDMOQIVIL-VEILYXNESA-N |
| XLogP | 4.77 |
| TPSA | 145.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|