C27H30Cl2N6O2 — CID 139515122
2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 139515122) has the molecular formula C27H30Cl2N6O2 and a molecular weight of 541.48 g/mol. Its IUPAC name is 2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | 2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 139515122 |
| Molecular Formula | C27H30Cl2N6O2 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | N/C(Cl)=C\N(N)c1ccc(Cl)cc1-c1cc(=O)n(C(Cc2ccccc2)C(=O)NC2CCCCC2)cn1 |
| InChI | InChI=1S/C27H30Cl2N6O2/c28-19-11-12-23(35(31)16-25(29)30)21(14-19)22-15-26(36)34(17-32-22)24(13-18-7-3-1-4-8-18)27(37)33-20-9-5-2-6-10-20/h1,3-4,7-8,11-12,14-17,20,24H,2,5-6,9-10,13,30-31H2,(H,33,37)/b25-16- |
| InChIKey | VHDVUSCNPCZCMG-XYGWBWBKSA-N |
| XLogP | 4.47 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|