C26H30Cl2N6O2 — CID 139515130
2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-N-(3-methylbutyl)-3-phenylpropanamide (PubChem CID 139515130) has the molecular formula C26H30Cl2N6O2 and a molecular weight of 529.47 g/mol. Its IUPAC name is 2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-N-(3-methylbutyl)-3-phenylpropanamide.
| Compound Name | 2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-N-(3-methylbutyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 139515130 |
| Molecular Formula | C26H30Cl2N6O2 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-N-(3-methylbutyl)-3-phenylpropanamide |
| SMILES | CC(C)CCNC(=O)C(Cc1ccccc1)n1cnc(-c2cc(Cl)ccc2N(N)/C=C(\N)Cl)cc1=O |
| InChI | InChI=1S/C26H30Cl2N6O2/c1-17(2)10-11-31-26(36)23(12-18-6-4-3-5-7-18)33-16-32-21(14-25(33)35)20-13-19(27)8-9-22(20)34(30)15-24(28)29/h3-9,13-17,23H,10-12,29-30H2,1-2H3,(H,31,36)/b24-15- |
| InChIKey | UXARSTYXGKWUKM-IWIPYMOSSA-N |
| XLogP | 4.19 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|