C26H29Cl2N7O4S — CID 139515029
1-[2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-phenylpropanoyl]piperidine-4-sulfonamide (PubChem CID 139515029) has the molecular formula C26H29Cl2N7O4S and a molecular weight of 606.54 g/mol. Its IUPAC name is 1-[2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-phenylpropanoyl]piperidine-4-sulfonamide.
| Compound Name | 1-[2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-phenylpropanoyl]piperidine-4-sulfonamide |
|---|---|
| PubChem CID | 139515029 |
| Molecular Formula | C26H29Cl2N7O4S |
| Molecular Weight | 606.54 g/mol |
| Exact Mass | 605.14 |
| IUPAC Name | 1-[2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-phenylpropanoyl]piperidine-4-sulfonamide |
| SMILES | N/C(Cl)=C\N(N)c1ccc(Cl)cc1-c1cc(=O)n(C(Cc2ccccc2)C(=O)N2CCC(S(N)(=O)=O)CC2)cn1 |
| InChI | InChI=1S/C26H29Cl2N7O4S/c27-18-6-7-22(35(30)15-24(28)29)20(13-18)21-14-25(36)34(16-32-21)23(12-17-4-2-1-3-5-17)26(37)33-10-8-19(9-11-33)40(31,38)39/h1-7,13-16,19,23H,8-12,29-30H2,(H2,31,38,39)/b24-15- |
| InChIKey | PVFWLUPYDJDBMF-IWIPYMOSSA-N |
| XLogP | 2.30 |
| TPSA | 170.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|