C21H21Cl2N5O — CID 126553759
6-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-3-(1-phenylpropan-2-yl)pyrimidin-4-one (PubChem CID 126553759) has the molecular formula C21H21Cl2N5O and a molecular weight of 430.34 g/mol. Its IUPAC name is 6-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-3-(1-phenylpropan-2-yl)pyrimidin-4-one.
| Compound Name | 6-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-3-(1-phenylpropan-2-yl)pyrimidin-4-one |
|---|---|
| PubChem CID | 126553759 |
| Molecular Formula | C21H21Cl2N5O |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 6-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-3-(1-phenylpropan-2-yl)pyrimidin-4-one |
| SMILES | CC(Cc1ccccc1)n1cnc(-c2cc(Cl)ccc2N(N)/C=C(\N)Cl)cc1=O |
| InChI | InChI=1S/C21H21Cl2N5O/c1-14(9-15-5-3-2-4-6-15)27-13-26-18(11-21(27)29)17-10-16(22)7-8-19(17)28(25)12-20(23)24/h2-8,10-14H,9,24-25H2,1H3/b20-12- |
| InChIKey | MLZXVMXQQJNBEN-NDENLUEZSA-N |
| XLogP | 4.04 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|