C27H28Cl2N8O2 — CID 139515126
2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-N-(2-ethyl-5-methylpyrazol-3-yl)-3-phenylpropanamide (PubChem CID 139515126) has the molecular formula C27H28Cl2N8O2 and a molecular weight of 567.48 g/mol. Its IUPAC name is 2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-N-(2-ethyl-5-methylpyrazol-3-yl)-3-phenylpropanamide.
| Compound Name | 2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-N-(2-ethyl-5-methylpyrazol-3-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 139515126 |
| Molecular Formula | C27H28Cl2N8O2 |
| Molecular Weight | 567.48 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | 2-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-N-(2-ethyl-5-methylpyrazol-3-yl)-3-phenylpropanamide |
| SMILES | CCn1nc(C)cc1NC(=O)C(Cc1ccccc1)n1cnc(-c2cc(Cl)ccc2N(N)/C=C(\N)Cl)cc1=O |
| InChI | InChI=1S/C27H28Cl2N8O2/c1-3-37-25(11-17(2)34-37)33-27(39)23(12-18-7-5-4-6-8-18)35-16-32-21(14-26(35)38)20-13-19(28)9-10-22(20)36(31)15-24(29)30/h4-11,13-16,23H,3,12,30-31H2,1-2H3,(H,33,39)/b24-15- |
| InChIKey | OZJHBSYUYQKTQO-IWIPYMOSSA-N |
| XLogP | 4.19 |
| TPSA | 137.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|