C21H25NO4S — CID 153072787
8-(2-aminophenyl)-1-(4-methylsulfonylphenyl)octane-1,7-dione (PubChem CID 153072787) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is 8-(2-aminophenyl)-1-(4-methylsulfonylphenyl)octane-1,7-dione.
| Compound Name | 8-(2-aminophenyl)-1-(4-methylsulfonylphenyl)octane-1,7-dione |
|---|---|
| PubChem CID | 153072787 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 8-(2-aminophenyl)-1-(4-methylsulfonylphenyl)octane-1,7-dione |
| SMILES | CS(=O)(=O)c1ccc(C(=O)CCCCCC(=O)Cc2ccccc2N)cc1 |
| InChI | InChI=1S/C21H25NO4S/c1-27(25,26)19-13-11-16(12-14-19)21(24)10-4-2-3-8-18(23)15-17-7-5-6-9-20(17)22/h5-7,9,11-14H,2-4,8,10,15,22H2,1H3 |
| InChIKey | VLRMLYMLFAXHDC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|