C23H21FO7S — CID 153083550
3-hydroxypropyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate (PubChem CID 153083550) has the molecular formula C23H21FO7S and a molecular weight of 460.48 g/mol. Its IUPAC name is 3-hydroxypropyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate.
| Compound Name | 3-hydroxypropyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 153083550 |
| Molecular Formula | C23H21FO7S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 3-hydroxypropyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate |
| SMILES | O=C(OCCCO)c1ccc(CS(=O)(=O)c2cccc(-c3cc(F)ccc3O)c2)cc1O |
| InChI | InChI=1S/C23H21FO7S/c24-17-6-8-21(26)20(13-17)16-3-1-4-18(12-16)32(29,30)14-15-5-7-19(22(27)11-15)23(28)31-10-2-9-25/h1,3-8,11-13,25-27H,2,9-10,14H2 |
| InChIKey | VNTCEKBHVXREBI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|