C29H36N2O6 — CID 153085999
(2R,10R,12R)-5,19-dihydroxy-10-(hydroxymethyl)-8,16,18-trimethoxy-6,7,17,21-tetramethyl-21-azapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4,6,8,15(20),16,18-hexaene-12-carbonitrile (PubChem CID 153085999) has the molecular formula C29H36N2O6 and a molecular weight of 508.62 g/mol. Its IUPAC name is (2R,10R,12R)-5,19-dihydroxy-10-(hydroxymethyl)-8,16,18-trimethoxy-6,7,17,21-tetramethyl-21-azapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4,6,8,15(20),16,18-hexaene-12-carbonitrile.
| Compound Name | (2R,10R,12R)-5,19-dihydroxy-10-(hydroxymethyl)-8,16,18-trimethoxy-6,7,17,21-tetramethyl-21-azapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4,6,8,15(20),16,18-hexaene-12-carbonitrile |
|---|---|
| PubChem CID | 153085999 |
| Molecular Formula | C29H36N2O6 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | (2R,10R,12R)-5,19-dihydroxy-10-(hydroxymethyl)-8,16,18-trimethoxy-6,7,17,21-tetramethyl-21-azapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4,6,8,15(20),16,18-hexaene-12-carbonitrile |
| SMILES | COc1c(C)c(OC)c2c(c1O)C1[C@@H]3Cc4c(O)c(C)c(C)c(OC)c4C(CO)C3[C@@H](C#N)C(C2)N1C |
| InChI | InChI=1S/C29H36N2O6/c1-12-13(2)28(36-6)22-16(25(12)33)8-15-21(19(22)11-32)18(10-30)20-9-17-23(24(15)31(20)4)26(34)29(37-7)14(3)27(17)35-5/h15,18-21,24,32-34H,8-9,11H2,1-7H3/t15-,18+,19?,20?,21?,24?/m1/s1 |
| InChIKey | VOFKXONPXFHIGQ-KOAZHWJASA-N |
| XLogP | 3.66 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|