C14H17ClF3N3 — CID 15310085
4-chloro-N-[(Z)-(1,1,1-trifluoro-3-piperidin-1-ylpropan-2-ylidene)amino]aniline (PubChem CID 15310085) has the molecular formula C14H17ClF3N3 and a molecular weight of 319.76 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-(1,1,1-trifluoro-3-piperidin-1-ylpropan-2-ylidene)amino]aniline.
| Compound Name | 4-chloro-N-[(Z)-(1,1,1-trifluoro-3-piperidin-1-ylpropan-2-ylidene)amino]aniline |
|---|---|
| PubChem CID | 15310085 |
| Molecular Formula | C14H17ClF3N3 |
| Molecular Weight | 319.76 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 4-chloro-N-[(Z)-(1,1,1-trifluoro-3-piperidin-1-ylpropan-2-ylidene)amino]aniline |
| SMILES | FC(F)(F)/C(CN1CCCCC1)=N\Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClF3N3/c15-11-4-6-12(7-5-11)19-20-13(14(16,17)18)10-21-8-2-1-3-9-21/h4-7,19H,1-3,8-10H2/b20-13- |
| InChIKey | BQFDLDLUEYMEML-MOSHPQCFSA-N |
| XLogP | 4.16 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.76 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|