C13H15ClF3N3O2S — CID 15310082
4-chloro-N-[(E)-(1,1,1-trifluoro-3-pyrrolidin-1-ylsulfonylpropan-2-ylidene)amino]aniline (PubChem CID 15310082) has the molecular formula C13H15ClF3N3O2S and a molecular weight of 369.80 g/mol. Its IUPAC name is 4-chloro-N-[(E)-(1,1,1-trifluoro-3-pyrrolidin-1-ylsulfonylpropan-2-ylidene)amino]aniline.
| Compound Name | 4-chloro-N-[(E)-(1,1,1-trifluoro-3-pyrrolidin-1-ylsulfonylpropan-2-ylidene)amino]aniline |
|---|---|
| PubChem CID | 15310082 |
| Molecular Formula | C13H15ClF3N3O2S |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 4-chloro-N-[(E)-(1,1,1-trifluoro-3-pyrrolidin-1-ylsulfonylpropan-2-ylidene)amino]aniline |
| SMILES | O=S(=O)(C/C(=N/Nc1ccc(Cl)cc1)C(F)(F)F)N1CCCC1 |
| InChI | InChI=1S/C13H15ClF3N3O2S/c14-10-3-5-11(6-4-10)18-19-12(13(15,16)17)9-23(21,22)20-7-1-2-8-20/h3-6,18H,1-2,7-9H2/b19-12- |
| InChIKey | DQTONNZTGJBFON-UNOMPAQXSA-N |
| XLogP | 3.10 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|