C23H24N2O3S — CID 153112192
N,N-dimethyl-3-[(3-naphthalen-1-ylsulfonyl-1H-isoindol-5-yl)oxy]propan-1-amine (PubChem CID 153112192) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is N,N-dimethyl-3-[(3-naphthalen-1-ylsulfonyl-1H-isoindol-5-yl)oxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[(3-naphthalen-1-ylsulfonyl-1H-isoindol-5-yl)oxy]propan-1-amine |
|---|---|
| PubChem CID | 153112192 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N,N-dimethyl-3-[(3-naphthalen-1-ylsulfonyl-1H-isoindol-5-yl)oxy]propan-1-amine |
| SMILES | CN(C)CCCOc1ccc2c(c1)C(S(=O)(=O)c1cccc3ccccc13)=NC2 |
| InChI | InChI=1S/C23H24N2O3S/c1-25(2)13-6-14-28-19-12-11-18-16-24-23(21(18)15-19)29(26,27)22-10-5-8-17-7-3-4-9-20(17)22/h3-5,7-12,15H,6,13-14,16H2,1-2H3 |
| InChIKey | VTDNUQWQXLBLGM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|