C23H25N3O3S — CID 69137588
6-[(3-naphthalen-1-ylsulfonyl-2H-indazol-5-yl)oxy]hexan-3-amine (PubChem CID 69137588) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is 6-[(3-naphthalen-1-ylsulfonyl-2H-indazol-5-yl)oxy]hexan-3-amine.
| Compound Name | 6-[(3-naphthalen-1-ylsulfonyl-2H-indazol-5-yl)oxy]hexan-3-amine |
|---|---|
| PubChem CID | 69137588 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 6-[(3-naphthalen-1-ylsulfonyl-2H-indazol-5-yl)oxy]hexan-3-amine |
| SMILES | CCC(N)CCCOc1ccc2n[nH]c(S(=O)(=O)c3cccc4ccccc34)c2c1 |
| InChI | InChI=1S/C23H25N3O3S/c1-2-17(24)9-6-14-29-18-12-13-21-20(15-18)23(26-25-21)30(27,28)22-11-5-8-16-7-3-4-10-19(16)22/h3-5,7-8,10-13,15,17H,2,6,9,14,24H2,1H3,(H,25,26) |
| InChIKey | SFVGCZFZHSXLOQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|